C13H26N2O2 — CID 63637854
N-(1,3-dioxan-4-ylmethyl)-N-propylpiperidin-3-amine (PubChem CID 63637854) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-N-propylpiperidin-3-amine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-N-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 63637854 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-N-propylpiperidin-3-amine |
| SMILES | CCCN(CC1CCOCO1)C1CCCNC1 |
| InChI | InChI=1S/C13H26N2O2/c1-2-7-15(12-4-3-6-14-9-12)10-13-5-8-16-11-17-13/h12-14H,2-11H2,1H3 |
| InChIKey | YQWMAOOBIFUPOD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |