C16H20N2O2 — CID 106627688
N-methyl-N-(piperidin-3-ylmethyl)-1-benzofuran-3-carboxamide (PubChem CID 106627688) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-methyl-N-(piperidin-3-ylmethyl)-1-benzofuran-3-carboxamide.
| Compound Name | N-methyl-N-(piperidin-3-ylmethyl)-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 106627688 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-methyl-N-(piperidin-3-ylmethyl)-1-benzofuran-3-carboxamide |
| SMILES | CN(CC1CCCNC1)C(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c1-18(10-12-5-4-8-17-9-12)16(19)14-11-20-15-7-3-2-6-13(14)15/h2-3,6-7,11-12,17H,4-5,8-10H2,1H3 |
| InChIKey | DLFBTHUDYTVWMZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |