C16H20Cl2N2O — CID 106628660
3,5-dichloro-N-cyclopropyl-N-(piperidin-3-ylmethyl)benzamide (PubChem CID 106628660) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.25 g/mol. Its IUPAC name is 3,5-dichloro-N-cyclopropyl-N-(piperidin-3-ylmethyl)benzamide.
| Compound Name | 3,5-dichloro-N-cyclopropyl-N-(piperidin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106628660 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3,5-dichloro-N-cyclopropyl-N-(piperidin-3-ylmethyl)benzamide |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N(CC1CCCNC1)C1CC1 |
| InChI | InChI=1S/C16H20Cl2N2O/c17-13-6-12(7-14(18)8-13)16(21)20(15-3-4-15)10-11-2-1-5-19-9-11/h6-8,11,15,19H,1-5,9-10H2 |
| InChIKey | YHBHKBZPLUMTBS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |