C10H16FNO — CID 106634877
2-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine (PubChem CID 106634877) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine.
| Compound Name | 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine |
|---|---|
| PubChem CID | 106634877 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[2,3-dihydrofuran-5-yl(fluoro)methyl]piperidine |
| SMILES | FC(C1=CCCO1)C1CCCCN1 |
| InChI | InChI=1S/C10H16FNO/c11-10(9-5-3-7-13-9)8-4-1-2-6-12-8/h5,8,10,12H,1-4,6-7H2 |
| InChIKey | FBQRVSMHDWSZTB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |