propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate

C12H24N2O2 — CID 106637068

IUPACpropan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate
SMILESCC(C)OC(=O)CN(C)CC1CCCNC1
InChIInChI=1S/C12H24N2O2/c1-10(2)16-12(15)9-14(3)8-11-5-4-6-13-7-11/h10-11,13H,4-9H2,1-3H3
InChIKeyFCTPDRPVAHBBRN-UHFFFAOYSA-N
MW228.34 g/mol
LogP0.87
Rot. Bonds5

About propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate

propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate (PubChem CID 106637068) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate.

Molecular Properties

Compound Namepropan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate
PubChem CID106637068
Molecular FormulaC12H24N2O2
Molecular Weight228.34 g/mol
Exact Mass228.18
IUPAC Namepropan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate
SMILESCC(C)OC(=O)CN(C)CC1CCCNC1
InChIInChI=1S/C12H24N2O2/c1-10(2)16-12(15)9-14(3)8-11-5-4-6-13-7-11/h10-11,13H,4-9H2,1-3H3
InChIKeyFCTPDRPVAHBBRN-UHFFFAOYSA-N
XLogP0.87
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.34
LogP ≤ 50.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate?
The IUPAC name of propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate (CID 106637068) is propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate.
What is the SMILES notation for propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate?
The canonical SMILES for propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate is CC(C)OC(=O)CN(C)CC1CCCNC1.
What is the InChIKey of propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate?
The InChIKey is FCTPDRPVAHBBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-10(2)16-12(15)9-14(3)8-11-5-4-6-13-7-11/h10-11,13H,4-9H2,1-3H3.
What are the key properties of propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate?
propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate has a molecular weight of 228.34 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[methyl(piperidin-3-ylmethyl)amino]acetate is sourced from PubChem (CID 106637068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).