C11H19ClN4S — CID 106638595
N-[(5-chlorothiadiazol-4-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine (PubChem CID 106638595) has the molecular formula C11H19ClN4S and a molecular weight of 274.82 g/mol. Its IUPAC name is N-[(5-chlorothiadiazol-4-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine.
| Compound Name | N-[(5-chlorothiadiazol-4-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106638595 |
| Molecular Formula | C11H19ClN4S |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[(5-chlorothiadiazol-4-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine |
| SMILES | CCN(Cc1nnsc1Cl)CC1CCCNC1 |
| InChI | InChI=1S/C11H19ClN4S/c1-2-16(7-9-4-3-5-13-6-9)8-10-11(12)17-15-14-10/h9,13H,2-8H2,1H3 |
| InChIKey | IRNGCVQVDNFJTB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |