C15H27BrN4 — CID 106639460
N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine (PubChem CID 106639460) has the molecular formula C15H27BrN4 and a molecular weight of 343.31 g/mol. Its IUPAC name is N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine.
| Compound Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 106639460 |
| Molecular Formula | C15H27BrN4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-3-ylmethyl)ethanamine |
| SMILES | CCc1nn(C)c(CN(CC)CC2CCCNC2)c1Br |
| InChI | InChI=1S/C15H27BrN4/c1-4-13-15(16)14(19(3)18-13)11-20(5-2)10-12-7-6-8-17-9-12/h12,17H,4-11H2,1-3H3 |
| InChIKey | WRCRFXDHJLCCKC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |