C16H27BrN4 — CID 79703289
N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-4-ylmethyl)cyclopropanamine (PubChem CID 79703289) has the molecular formula C16H27BrN4 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-4-ylmethyl)cyclopropanamine.
| Compound Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-4-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 79703289 |
| Molecular Formula | C16H27BrN4 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-N-(piperidin-4-ylmethyl)cyclopropanamine |
| SMILES | CCc1nn(C)c(CN(CC2CCNCC2)C2CC2)c1Br |
| InChI | InChI=1S/C16H27BrN4/c1-3-14-16(17)15(20(2)19-14)11-21(13-4-5-13)10-12-6-8-18-9-7-12/h12-13,18H,3-11H2,1-2H3 |
| InChIKey | WTGMELBLYIMQKD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |