C17H34O4Si — CID 10664204
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooctanoate (PubChem CID 10664204) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooctanoate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooctanoate |
|---|---|
| PubChem CID | 10664204 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-oxooctanoate |
| SMILES | CCOC(=O)CC(C)(CCCCC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-8-20-15(19)14-17(5,12-10-9-11-13-18)21-22(6,7)16(2,3)4/h13H,8-12,14H2,1-7H3 |
| InChIKey | CGWCJUBGTRDQKY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|