C18H24N2O4 — CID 10664319
dimethyl (5S,6R,7R,7aS)-1-benzyl-6-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate (PubChem CID 10664319) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is dimethyl (5S,6R,7R,7aS)-1-benzyl-6-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate.
| Compound Name | dimethyl (5S,6R,7R,7aS)-1-benzyl-6-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
|---|---|
| PubChem CID | 10664319 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | dimethyl (5S,6R,7R,7aS)-1-benzyl-6-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-a]imidazole-5,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)[C@@H](C(=O)OC)N2CCN(Cc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C18H24N2O4/c1-12-14(17(21)23-2)16-19(11-13-7-5-4-6-8-13)9-10-20(16)15(12)18(22)24-3/h4-8,12,14-16H,9-11H2,1-3H3/t12-,14-,15+,16+/m1/s1 |
| InChIKey | YQFYKLJAVIIFIL-OJLVUWQFSA-N |
| XLogP | 1.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |