C16H28N4O — CID 106644195
3-[piperidin-3-ylmethyl(propyl)amino]-1-propan-2-ylpyrazin-2-one (PubChem CID 106644195) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-[piperidin-3-ylmethyl(propyl)amino]-1-propan-2-ylpyrazin-2-one.
| Compound Name | 3-[piperidin-3-ylmethyl(propyl)amino]-1-propan-2-ylpyrazin-2-one |
|---|---|
| PubChem CID | 106644195 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-[piperidin-3-ylmethyl(propyl)amino]-1-propan-2-ylpyrazin-2-one |
| SMILES | CCCN(CC1CCCNC1)c1nccn(C(C)C)c1=O |
| InChI | InChI=1S/C16H28N4O/c1-4-9-19(12-14-6-5-7-17-11-14)15-16(21)20(13(2)3)10-8-18-15/h8,10,13-14,17H,4-7,9,11-12H2,1-3H3 |
| InChIKey | ZHPSLPPDKSXIFI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |