C14H21ClFN3 — CID 106644246
5-chloro-3-fluoro-N-(piperidin-3-ylmethyl)-N-propylpyridin-2-amine (PubChem CID 106644246) has the molecular formula C14H21ClFN3 and a molecular weight of 285.79 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(piperidin-3-ylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(piperidin-3-ylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 106644246 |
| Molecular Formula | C14H21ClFN3 |
| Molecular Weight | 285.79 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 5-chloro-3-fluoro-N-(piperidin-3-ylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCN(CC1CCCNC1)c1ncc(Cl)cc1F |
| InChI | InChI=1S/C14H21ClFN3/c1-2-6-19(10-11-4-3-5-17-8-11)14-13(16)7-12(15)9-18-14/h7,9,11,17H,2-6,8,10H2,1H3 |
| InChIKey | IMHOCBVDXBFPTM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |