C13H16ClFN2 — CID 79727186
5-chloro-N,N-bis(cyclopropylmethyl)-3-fluoropyridin-2-amine (PubChem CID 79727186) has the molecular formula C13H16ClFN2 and a molecular weight of 254.74 g/mol. Its IUPAC name is 5-chloro-N,N-bis(cyclopropylmethyl)-3-fluoropyridin-2-amine.
| Compound Name | 5-chloro-N,N-bis(cyclopropylmethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 79727186 |
| Molecular Formula | C13H16ClFN2 |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 5-chloro-N,N-bis(cyclopropylmethyl)-3-fluoropyridin-2-amine |
| SMILES | Fc1cc(Cl)cnc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C13H16ClFN2/c14-11-5-12(15)13(16-6-11)17(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | LLPCHWJEMWRQDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |