C13H17Br2F — CID 106646666
1-bromo-3-(3-bromo-4,4-dimethylpentyl)-2-fluorobenzene (PubChem CID 106646666) has the molecular formula C13H17Br2F and a molecular weight of 352.09 g/mol. Its IUPAC name is 1-bromo-3-(3-bromo-4,4-dimethylpentyl)-2-fluorobenzene.
| Compound Name | 1-bromo-3-(3-bromo-4,4-dimethylpentyl)-2-fluorobenzene |
|---|---|
| PubChem CID | 106646666 |
| Molecular Formula | C13H17Br2F |
| Molecular Weight | 352.09 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 1-bromo-3-(3-bromo-4,4-dimethylpentyl)-2-fluorobenzene |
| SMILES | CC(C)(C)C(Br)CCc1cccc(Br)c1F |
| InChI | InChI=1S/C13H17Br2F/c1-13(2,3)11(15)8-7-9-5-4-6-10(14)12(9)16/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | KJRJEWOGZTUNHV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|