C11H11BrFN3S — CID 106646781
4-(3-bromo-2-fluorophenyl)-N-propyl-1,2,5-thiadiazol-3-amine (PubChem CID 106646781) has the molecular formula C11H11BrFN3S and a molecular weight of 316.20 g/mol. Its IUPAC name is 4-(3-bromo-2-fluorophenyl)-N-propyl-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-(3-bromo-2-fluorophenyl)-N-propyl-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 106646781 |
| Molecular Formula | C11H11BrFN3S |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 4-(3-bromo-2-fluorophenyl)-N-propyl-1,2,5-thiadiazol-3-amine |
| SMILES | CCCNc1nsnc1-c1cccc(Br)c1F |
| InChI | InChI=1S/C11H11BrFN3S/c1-2-6-14-11-10(15-17-16-11)7-4-3-5-8(12)9(7)13/h3-5H,2,6H2,1H3,(H,14,16) |
| InChIKey | ROQHSABMLAPCJA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |