C15H19N3S — CID 116506918
4-(4-cyclobutylphenyl)-N-propyl-1,2,5-thiadiazol-3-amine (PubChem CID 116506918) has the molecular formula C15H19N3S and a molecular weight of 273.41 g/mol. Its IUPAC name is 4-(4-cyclobutylphenyl)-N-propyl-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-(4-cyclobutylphenyl)-N-propyl-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 116506918 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-(4-cyclobutylphenyl)-N-propyl-1,2,5-thiadiazol-3-amine |
| SMILES | CCCNc1nsnc1-c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C15H19N3S/c1-2-10-16-15-14(17-19-18-15)13-8-6-12(7-9-13)11-4-3-5-11/h6-9,11H,2-5,10H2,1H3,(H,16,18) |
| InChIKey | QQKFYBNURIADRW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |