C18H23N3 — CID 116506929
4-(4-cyclobutylphenyl)-6-methyl-N-propylpyrimidin-2-amine (PubChem CID 116506929) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-(4-cyclobutylphenyl)-6-methyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-(4-cyclobutylphenyl)-6-methyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116506929 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-(4-cyclobutylphenyl)-6-methyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nc(C)cc(-c2ccc(C3CCC3)cc2)n1 |
| InChI | InChI=1S/C18H23N3/c1-3-11-19-18-20-13(2)12-17(21-18)16-9-7-15(8-10-16)14-5-4-6-14/h7-10,12,14H,3-6,11H2,1-2H3,(H,19,20,21) |
| InChIKey | CEKSOJKPHDBMKL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |