C13H15N3OS — CID 114523366
4-(3-cyclopropyloxyphenyl)-N-ethyl-1,2,5-thiadiazol-3-amine (PubChem CID 114523366) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-(3-cyclopropyloxyphenyl)-N-ethyl-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-(3-cyclopropyloxyphenyl)-N-ethyl-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 114523366 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-(3-cyclopropyloxyphenyl)-N-ethyl-1,2,5-thiadiazol-3-amine |
| SMILES | CCNc1nsnc1-c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-14-13-12(15-18-16-13)9-4-3-5-11(8-9)17-10-6-7-10/h3-5,8,10H,2,6-7H2,1H3,(H,14,16) |
| InChIKey | AFUUQYZMJVIHML-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |