C22H27NO2 — CID 10664700
(4-tert-butylphenyl)-(3-hydroxy-3-phenylpiperidin-1-yl)methanone (PubChem CID 10664700) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(3-hydroxy-3-phenylpiperidin-1-yl)methanone.
| Compound Name | (4-tert-butylphenyl)-(3-hydroxy-3-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 10664700 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (4-tert-butylphenyl)-(3-hydroxy-3-phenylpiperidin-1-yl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCCC(O)(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-21(2,3)18-12-10-17(11-13-18)20(24)23-15-7-14-22(25,16-23)19-8-5-4-6-9-19/h4-6,8-13,25H,7,14-16H2,1-3H3 |
| InChIKey | BOYPTDJMFZSMFA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |