C12H22N2 — CID 106649342
[cyclohepten-1-yl-(1-methylcyclopropyl)methyl]hydrazine (PubChem CID 106649342) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is [cyclohepten-1-yl-(1-methylcyclopropyl)methyl]hydrazine.
| Compound Name | [cyclohepten-1-yl-(1-methylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106649342 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | [cyclohepten-1-yl-(1-methylcyclopropyl)methyl]hydrazine |
| SMILES | CC1(C(NN)C2=CCCCCC2)CC1 |
| InChI | InChI=1S/C12H22N2/c1-12(8-9-12)11(14-13)10-6-4-2-3-5-7-10/h6,11,14H,2-5,7-9,13H2,1H3 |
| InChIKey | DWZUTDGGZCFXOG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|