C14H30N2 — CID 143962805
1-methyl-2-[(E)-3,5,5,7,7-pentamethyloct-2-en-4-yl]hydrazine (PubChem CID 143962805) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-methyl-2-[(E)-3,5,5,7,7-pentamethyloct-2-en-4-yl]hydrazine.
| Compound Name | 1-methyl-2-[(E)-3,5,5,7,7-pentamethyloct-2-en-4-yl]hydrazine |
|---|---|
| PubChem CID | 143962805 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-methyl-2-[(E)-3,5,5,7,7-pentamethyloct-2-en-4-yl]hydrazine |
| SMILES | C/C=C(\C)C(NNC)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-9-11(2)12(16-15-8)14(6,7)10-13(3,4)5/h9,12,15-16H,10H2,1-8H3/b11-9+ |
| InChIKey | NZIUXDTZMAJJNY-PKNBQFBNSA-N |
| XLogP | 3.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|