C8H14F2N2 — CID 106649487
[1-(cyclohexen-1-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 106649487) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(cyclohexen-1-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 106649487 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | [1-(cyclohexen-1-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(C1=CCCCC1)C(F)F |
| InChI | InChI=1S/C8H14F2N2/c9-8(10)7(12-11)6-4-2-1-3-5-6/h4,7-8,12H,1-3,5,11H2 |
| InChIKey | MDPNFJMQRMGHPE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|