About N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine
N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine (PubChem CID 142330392) has the molecular formula C9H18F3N3
and a molecular weight of 225.26 g/mol. Its IUPAC name is N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine.
Molecular Properties
| Compound Name | N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine |
| PubChem CID | 142330392 |
| Molecular Formula | C9H18F3N3 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine |
| SMILES | CNC.NNC1CCC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F3N2.C2H7N/c8-7(9,10)5-2-1-3-6(4-5)12-11;1-3-2/h2,6,12H,1,3-4,11H2;3H,1-2H3 |
| InChIKey | QUCHXOWDOXYWNW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine?
The IUPAC name of N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine (CID 142330392) is N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine.
What is the SMILES notation for N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine?
The canonical SMILES for N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine is CNC.NNC1CCC=C(C(F)(F)F)C1.
What is the InChIKey of N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine?
The InChIKey is QUCHXOWDOXYWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2.C2H7N/c8-7(9,10)5-2-1-3-6(4-5)12-11;1-3-2/h2,6,12H,1,3-4,11H2;3H,1-2H3.
What are the key properties of N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine?
N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine has a molecular weight of 225.26 g/mol, XLogP of 1.33, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;[3-(trifluoromethyl)cyclohex-3-en-1-yl]hydrazine is sourced from PubChem (CID 142330392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).