C12H21F3N2O — CID 106649724
[1-(cycloocten-1-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine (PubChem CID 106649724) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is [1-(cycloocten-1-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine.
| Compound Name | [1-(cycloocten-1-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 106649724 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [1-(cycloocten-1-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
| SMILES | NNC(COCC(F)(F)F)C1=CCCCCCC1 |
| InChI | InChI=1S/C12H21F3N2O/c13-12(14,15)9-18-8-11(17-16)10-6-4-2-1-3-5-7-10/h6,11,17H,1-5,7-9,16H2 |
| InChIKey | LAOQJWOYQQJOQX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|