C12H20F4N2O — CID 106649728
[1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 106649728) has the molecular formula C12H20F4N2O and a molecular weight of 284.30 g/mol. Its IUPAC name is [1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 106649728 |
| Molecular Formula | C12H20F4N2O |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [1-(cyclohepten-1-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)C1=CCCCCC1 |
| InChI | InChI=1S/C12H20F4N2O/c13-11(14)12(15,16)8-19-7-10(18-17)9-5-3-1-2-4-6-9/h5,10-11,18H,1-4,6-8,17H2 |
| InChIKey | XAVSSYDPOHFVRG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|