C13H26N2 — CID 106653532
1-(cyclohepten-1-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine (PubChem CID 106653532) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine.
| Compound Name | 1-(cyclohepten-1-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 106653532 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-N,2-N,2-trimethylpropane-1,2-diamine |
| SMILES | CN(C)C(C)(C)C(N)C1=CCCCCC1 |
| InChI | InChI=1S/C13H26N2/c1-13(2,15(3)4)12(14)11-9-7-5-6-8-10-11/h9,12H,5-8,10,14H2,1-4H3 |
| InChIKey | YERPIDIROOKOGI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|