C19H36N2 — CID 106653570
1-(cyclohepten-1-yl)-2-methyl-2-piperidin-1-yl-N-propylpropan-1-amine (PubChem CID 106653570) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-methyl-2-piperidin-1-yl-N-propylpropan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-2-methyl-2-piperidin-1-yl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 106653570 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-methyl-2-piperidin-1-yl-N-propylpropan-1-amine |
| SMILES | CCCNC(C1=CCCCCC1)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C19H36N2/c1-4-14-20-18(17-12-8-5-6-9-13-17)19(2,3)21-15-10-7-11-16-21/h12,18,20H,4-11,13-16H2,1-3H3 |
| InChIKey | MWNDLSMRQQBNIX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|