C13H20F5N — CID 55195514
1-(cyclohepten-1-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine (PubChem CID 55195514) has the molecular formula C13H20F5N and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 55195514 |
| Molecular Formula | C13H20F5N |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(C1=CCCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H20F5N/c1-2-9-19-11(12(14,15)13(16,17)18)10-7-5-3-4-6-8-10/h7,11,19H,2-6,8-9H2,1H3 |
| InChIKey | DLQSHJMSRDMNHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|