C13H25NO2 — CID 106653818
N-[1-(cyclohexen-1-yl)-2,2-dimethoxyethyl]propan-1-amine (PubChem CID 106653818) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[1-(cyclohexen-1-yl)-2,2-dimethoxyethyl]propan-1-amine.
| Compound Name | N-[1-(cyclohexen-1-yl)-2,2-dimethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 106653818 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | N-[1-(cyclohexen-1-yl)-2,2-dimethoxyethyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCC1)C(OC)OC |
| InChI | InChI=1S/C13H25NO2/c1-4-10-14-12(13(15-2)16-3)11-8-6-5-7-9-11/h8,12-14H,4-7,9-10H2,1-3H3 |
| InChIKey | LBSUXZLOBGHHRQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|