C14H27NO2S — CID 113422022
1-(cyclohepten-1-yl)-2-methylsulfonyl-N-propylpropan-1-amine (PubChem CID 113422022) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-methylsulfonyl-N-propylpropan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-2-methylsulfonyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 113422022 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-methylsulfonyl-N-propylpropan-1-amine |
| SMILES | CCCNC(C1=CCCCCC1)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C14H27NO2S/c1-4-11-15-14(12(2)18(3,16)17)13-9-7-5-6-8-10-13/h9,12,14-15H,4-8,10-11H2,1-3H3 |
| InChIKey | HPZYBRJYBRVMMN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|