C19H35NO — CID 106654677
N-[cyclohexen-1-yl-(1-methoxy-4,4-dimethylcyclohexyl)methyl]propan-1-amine (PubChem CID 106654677) has the molecular formula C19H35NO and a molecular weight of 293.50 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(1-methoxy-4,4-dimethylcyclohexyl)methyl]propan-1-amine.
| Compound Name | N-[cyclohexen-1-yl-(1-methoxy-4,4-dimethylcyclohexyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106654677 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | N-[cyclohexen-1-yl-(1-methoxy-4,4-dimethylcyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCC1)C1(OC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C19H35NO/c1-5-15-20-17(16-9-7-6-8-10-16)19(21-4)13-11-18(2,3)12-14-19/h9,17,20H,5-8,10-15H2,1-4H3 |
| InChIKey | JTRANIASDKOZLA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|