C18H31F2N — CID 106656859
N-[cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine (PubChem CID 106656859) has the molecular formula C18H31F2N and a molecular weight of 299.45 g/mol. Its IUPAC name is N-[cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine.
| Compound Name | N-[cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106656859 |
| Molecular Formula | C18H31F2N |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | N-[cycloocten-1-yl-(4,4-difluorocyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCCCC1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H31F2N/c1-2-14-21-17(15-8-6-4-3-5-7-9-15)16-10-12-18(19,20)13-11-16/h8,16-17,21H,2-7,9-14H2,1H3 |
| InChIKey | MZHOKAJXMDMERW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|