C13H23N — CID 62079995
N-[cyclopenten-1-yl-(2-methylcyclopropyl)methyl]propan-1-amine (PubChem CID 62079995) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N-[cyclopenten-1-yl-(2-methylcyclopropyl)methyl]propan-1-amine.
| Compound Name | N-[cyclopenten-1-yl-(2-methylcyclopropyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62079995 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-[cyclopenten-1-yl-(2-methylcyclopropyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCC1)C1CC1C |
| InChI | InChI=1S/C13H23N/c1-3-8-14-13(12-9-10(12)2)11-6-4-5-7-11/h6,10,12-14H,3-5,7-9H2,1-2H3 |
| InChIKey | HKOYQHDBXGIJSZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|