C18H33NS2 — CID 106654173
N-[cycloocten-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]propan-1-amine (PubChem CID 106654173) has the molecular formula C18H33NS2 and a molecular weight of 327.60 g/mol. Its IUPAC name is N-[cycloocten-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]propan-1-amine.
| Compound Name | N-[cycloocten-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106654173 |
| Molecular Formula | C18H33NS2 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | N-[cycloocten-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCCCC1)C1SCCSC1CC |
| InChI | InChI=1S/C18H33NS2/c1-3-12-19-17(15-10-8-6-5-7-9-11-15)18-16(4-2)20-13-14-21-18/h10,16-19H,3-9,11-14H2,1-2H3 |
| InChIKey | XFRYMOCZLRISEH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|