C15H27NS2 — CID 106654169
N-[cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]ethanamine (PubChem CID 106654169) has the molecular formula C15H27NS2 and a molecular weight of 285.52 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]ethanamine.
| Compound Name | N-[cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106654169 |
| Molecular Formula | C15H27NS2 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[cyclohexen-1-yl-(3-ethyl-1,4-dithian-2-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)C1SCCSC1CC |
| InChI | InChI=1S/C15H27NS2/c1-3-13-15(18-11-10-17-13)14(16-4-2)12-8-6-5-7-9-12/h8,13-16H,3-7,9-11H2,1-2H3 |
| InChIKey | BRFABJMQVOFQQZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|