C17H31N — CID 66477455
N-[cyclohepten-1-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine (PubChem CID 66477455) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N-[cyclohepten-1-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[cyclohepten-1-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 66477455 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N-[cyclohepten-1-yl-(2,2,3,3-tetramethylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H31N/c1-6-18-14(13-11-9-7-8-10-12-13)15-16(2,3)17(15,4)5/h11,14-15,18H,6-10,12H2,1-5H3 |
| InChIKey | OJUAMDCAYPRDEP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|