C20H29N — CID 106653336
N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1H-inden-2-yl)methyl]ethanamine (PubChem CID 106653336) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1H-inden-2-yl)methyl]ethanamine.
| Compound Name | N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1H-inden-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106653336 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1H-inden-2-yl)methyl]ethanamine |
| SMILES | CCNC(/C1=C/CCCCCC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H29N/c1-2-21-20(16-10-6-4-3-5-7-11-16)19-14-17-12-8-9-13-18(17)15-19/h8-10,12-13,19-21H,2-7,11,14-15H2,1H3/b16-10+ |
| InChIKey | QHDYGWRPKQIJHQ-MHWRWJLKSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|