C18H27NS — CID 106657058
N-[cyclohepten-1-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]ethanamine (PubChem CID 106657058) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is N-[cyclohepten-1-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]ethanamine.
| Compound Name | N-[cyclohepten-1-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106657058 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-[cyclohepten-1-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)C1CCCc2sccc21 |
| InChI | InChI=1S/C18H27NS/c1-2-19-18(14-8-5-3-4-6-9-14)16-10-7-11-17-15(16)12-13-20-17/h8,12-13,16,18-19H,2-7,9-11H2,1H3 |
| InChIKey | YHUGQPMHRUNFOF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|