C19H27NS — CID 106656525
N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1-benzothiophen-3-yl)methyl]ethanamine (PubChem CID 106656525) has the molecular formula C19H27NS and a molecular weight of 301.50 g/mol. Its IUPAC name is N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1-benzothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1-benzothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106656525 |
| Molecular Formula | C19H27NS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[[(1E)-cycloocten-1-yl]-(2,3-dihydro-1-benzothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(/C1=C/CCCCCC1)C1CSc2ccccc21 |
| InChI | InChI=1S/C19H27NS/c1-2-20-19(15-10-6-4-3-5-7-11-15)17-14-21-18-13-9-8-12-16(17)18/h8-10,12-13,17,19-20H,2-7,11,14H2,1H3/b15-10+ |
| InChIKey | ZTUJGLHEUIRVHI-XNTDXEJSSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|