C16H31N3 — CID 106653850
N-[cyclohepten-1-yl-(1,4-dimethylpiperazin-2-yl)methyl]ethanamine (PubChem CID 106653850) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is N-[cyclohepten-1-yl-(1,4-dimethylpiperazin-2-yl)methyl]ethanamine.
| Compound Name | N-[cyclohepten-1-yl-(1,4-dimethylpiperazin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106653850 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | N-[cyclohepten-1-yl-(1,4-dimethylpiperazin-2-yl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCCCC1)C1CN(C)CCN1C |
| InChI | InChI=1S/C16H31N3/c1-4-17-16(14-9-7-5-6-8-10-14)15-13-18(2)11-12-19(15)3/h9,15-17H,4-8,10-13H2,1-3H3 |
| InChIKey | FQDLSXYBRNRWPW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|