C15H29N3 — CID 106654174
1-(cyclohepten-1-yl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine (PubChem CID 106654174) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 106654174 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-(1,4-dimethylpiperazin-2-yl)ethanamine |
| SMILES | CN1CCN(C)C(CC(N)C2=CCCCCC2)C1 |
| InChI | InChI=1S/C15H29N3/c1-17-9-10-18(2)14(12-17)11-15(16)13-7-5-3-4-6-8-13/h7,14-15H,3-6,8-12,16H2,1-2H3 |
| InChIKey | KLMLGNXZGJPKJX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|