C15H25N3S2 — CID 115388238
3-[(3-ethyl-1,4-dithian-2-yl)-(propylamino)methyl]pyridin-2-amine (PubChem CID 115388238) has the molecular formula C15H25N3S2 and a molecular weight of 311.52 g/mol. Its IUPAC name is 3-[(3-ethyl-1,4-dithian-2-yl)-(propylamino)methyl]pyridin-2-amine.
| Compound Name | 3-[(3-ethyl-1,4-dithian-2-yl)-(propylamino)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115388238 |
| Molecular Formula | C15H25N3S2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[(3-ethyl-1,4-dithian-2-yl)-(propylamino)methyl]pyridin-2-amine |
| SMILES | CCCNC(c1cccnc1N)C1SCCSC1CC |
| InChI | InChI=1S/C15H25N3S2/c1-3-7-17-13(11-6-5-8-18-15(11)16)14-12(4-2)19-9-10-20-14/h5-6,8,12-14,17H,3-4,7,9-10H2,1-2H3,(H2,16,18) |
| InChIKey | BULXJNYLICNSGX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |