C12H20F3N — CID 62078170
1-(cyclohexen-1-yl)-3,3,3-trifluoro-N-propylpropan-1-amine (PubChem CID 62078170) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3,3,3-trifluoro-N-propylpropan-1-amine.
| Compound Name | 1-(cyclohexen-1-yl)-3,3,3-trifluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62078170 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3,3,3-trifluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(CC(F)(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C12H20F3N/c1-2-8-16-11(9-12(13,14)15)10-6-4-3-5-7-10/h6,11,16H,2-5,7-9H2,1H3 |
| InChIKey | RMBUKITZGWQJQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|