About cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine
cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine (PubChem CID 106653933) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine.
Molecular Properties
| Compound Name | cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine |
| PubChem CID | 106653933 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine |
| SMILES | NC(C1=CCCCCC1)C1CN2CCN1CC2 |
| InChI | InChI=1S/C14H25N3/c15-14(12-5-3-1-2-4-6-12)13-11-16-7-9-17(13)10-8-16/h5,13-14H,1-4,6-11,15H2 |
| InChIKey | HEKRNTZFQUHZNF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine?
The IUPAC name of cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine (CID 106653933) is cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine.
What is the SMILES notation for cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine?
The canonical SMILES for cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine is NC(C1=CCCCCC1)C1CN2CCN1CC2.
What is the InChIKey of cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine?
The InChIKey is HEKRNTZFQUHZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3/c15-14(12-5-3-1-2-4-6-12)13-11-16-7-9-17(13)10-8-16/h5,13-14H,1-4,6-11,15H2.
What are the key properties of cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine?
cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine has a molecular weight of 235.37 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepten-1-yl(1,4-diazabicyclo[2.2.2]octan-2-yl)methanamine is sourced from PubChem (CID 106653933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).