C19H30N2 — CID 106654247
N-[[(1E)-cycloocten-1-yl]-(3-ethyl-4-pyridinyl)methyl]propan-1-amine (PubChem CID 106654247) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is N-[[(1E)-cycloocten-1-yl]-(3-ethyl-4-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[[(1E)-cycloocten-1-yl]-(3-ethyl-4-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106654247 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-[[(1E)-cycloocten-1-yl]-(3-ethyl-4-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(/C1=C/CCCCCC1)c1ccncc1CC |
| InChI | InChI=1S/C19H30N2/c1-3-13-21-19(17-10-8-6-5-7-9-11-17)18-12-14-20-15-16(18)4-2/h10,12,14-15,19,21H,3-9,11,13H2,1-2H3/b17-10+ |
| InChIKey | SRVYSNFTTQWXOR-LICLKQGHSA-N |
| XLogP | 4.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|