C15H29NO — CID 106654510
1-(cyclohepten-1-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine (PubChem CID 106654510) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 106654510 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-methoxy-N,3,3-trimethylbutan-1-amine |
| SMILES | CNC(C1=CCCCCC1)C(OC)C(C)(C)C |
| InChI | InChI=1S/C15H29NO/c1-15(2,3)14(17-5)13(16-4)12-10-8-6-7-9-11-12/h10,13-14,16H,6-9,11H2,1-5H3 |
| InChIKey | JEVFQBWPWKUNOU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|