C14H27NO — CID 106654542
1-(cyclohepten-1-yl)-2-methoxy-N,2-dimethylbutan-1-amine (PubChem CID 106654542) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-2-methoxy-N,2-dimethylbutan-1-amine.
| Compound Name | 1-(cyclohepten-1-yl)-2-methoxy-N,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 106654542 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 1-(cyclohepten-1-yl)-2-methoxy-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(OC)C(NC)C1=CCCCCC1 |
| InChI | InChI=1S/C14H27NO/c1-5-14(2,16-4)13(15-3)12-10-8-6-7-9-11-12/h10,13,15H,5-9,11H2,1-4H3 |
| InChIKey | OTDVKHUTAQKHLL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|