C12H16F3NO — CID 106655348
cyclohexen-1-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 106655348) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is cyclohexen-1-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | cyclohexen-1-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 106655348 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | cyclohexen-1-yl-[3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | O=C(C1=CCCCC1)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C12H16F3NO/c13-12(14,15)11(6-7-16-8-11)10(17)9-4-2-1-3-5-9/h4,16H,1-3,5-8H2 |
| InChIKey | NLSWVNRYSXFESL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |