C13H20N2O4S — CID 106658015
4-[[(2,2-dimethyl-1,3-dioxan-5-yl)amino]methyl]benzenesulfonamide (PubChem CID 106658015) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 4-[[(2,2-dimethyl-1,3-dioxan-5-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(2,2-dimethyl-1,3-dioxan-5-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106658015 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4-[[(2,2-dimethyl-1,3-dioxan-5-yl)amino]methyl]benzenesulfonamide |
| SMILES | CC1(C)OCC(NCc2ccc(S(N)(=O)=O)cc2)CO1 |
| InChI | InChI=1S/C13H20N2O4S/c1-13(2)18-8-11(9-19-13)15-7-10-3-5-12(6-4-10)20(14,16)17/h3-6,11,15H,7-9H2,1-2H3,(H2,14,16,17) |
| InChIKey | IVPRJIPRCVWDEL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |