C15H23NO3 — CID 106658557
N-[2-(ethoxymethyl)phenyl]-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 106658557) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-[2-(ethoxymethyl)phenyl]-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | N-[2-(ethoxymethyl)phenyl]-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658557 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-[2-(ethoxymethyl)phenyl]-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CCOCc1ccccc1NC1COC(C)(C)OC1 |
| InChI | InChI=1S/C15H23NO3/c1-4-17-9-12-7-5-6-8-14(12)16-13-10-18-15(2,3)19-11-13/h5-8,13,16H,4,9-11H2,1-3H3 |
| InChIKey | JJYTXBOOXOVLOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |